Compound Q&A

What industries use Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7)?

Answer

Methyl 1-benzyl-4-piperidinecarboxylate
Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) is primarily used in the pharmaceutical and chemical industries as a precursor in the synthesis of various drugs and other organic compounds. It is also utilized in polymer chemistry for the development of certain functional polymers and in the production of sensors and semiconductors.

About

CAS No 10315-06-7
English Name Methyl 1-benzyl-4-piperidinecarboxylate
Molecular Formula C14H19NO2
Molecular Weight 233.31 g/mol
SMILES COC(=O)C1CCN(CC1)CC2=CC=CC=C2
InChIKey MXOZSPRDEKPWCW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7)?

Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) is a crystalline compound with a molecular...

Compound Q&A

How is Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) typically synthesized?

Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) is often synthesized via a condensation re...

Compound Q&A

What precautions should be taken when handling Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7)?

When handling Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...