Compound Q&A

How is Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) typically synthesized?

Answer

Methyl 1-benzyl-4-piperidinecarboxylate
Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) is often synthesized via a condensation reaction between benzoic acid and 4-piperidinemethanol. The reaction typically uses a catalyst such as dicyclohexylcarbodiimide (DCC) and 4-dimethylaminopyridine (DMAP). The yield is generally above 85%, and the product is isolated by purification techniques such as recrystallization from ethanol.

About

CAS No 10315-06-7
English Name Methyl 1-benzyl-4-piperidinecarboxylate
Molecular Formula C14H19NO2
Molecular Weight 233.31 g/mol
SMILES COC(=O)C1CCN(CC1)CC2=CC=CC=C2
InChIKey MXOZSPRDEKPWCW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7)?

Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) is a crystalline compound with a molecular...

Compound Q&A

What industries use Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7)?

Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7) is primarily used in the pharmaceutical an...

Compound Q&A

What precautions should be taken when handling Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7)?

When handling Methyl 1-benzyl-4-piperidinecarboxylate (CAS: 10315-06-7), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...