Compound Q&A

What are the physical and chemical properties of (4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline (CAS: 13504-85-3)?

Answer

(4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline
(4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline is a white crystalline solid. Its molecular weight is approximately 300.36 g/mol. It is poorly water-soluble but soluble in organic solvents. This compound exhibits moderate reactivity, particularly towards nucleophilic attack at the hydroxyl group.

About

CAS No 13504-85-3
English Name (4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline
Molecular Formula C13H15NO5
Molecular Weight 265.27 g/mol
SMILES O[C@@H]1C[C@H](N(C1)C(=O)OCc2ccccc2)C(=O)O
InChIKey WWVCWLBEARZMAH-MNOVXSKESA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is (4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline (CAS: 13504-85-3) typically synthesized?

(4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline is synthesized by the condensation of benzyloxycarb...

Compound Q&A

What industries use (4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline (CAS: 13504-85-3)?

(4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline is primarily used in pharmaceuticals for the synthe...

Compound Q&A

What precautions should be taken when handling (4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline (CAS: 13504-85-3)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...