Compound Q&A

What industries use Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0)?

Answer

Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate
Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0) is widely used in the pharmaceutical, polymer, and semiconductor industries. It serves as a pH regulator and buffer in pharmaceutical formulations, improves the performance of polymer solutions, and is used in semiconductor manufacturing for etching and cleaning processes. Additionally, it finds applications in sensors and as a complexing agent in various analytical procedures.

About

English Name Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate
Molecular Formula C7H16NNaO6S
Molecular Weight 265.26 g/mol
SMILES C(CO)N(CCO)CC(CS(=O)(=O)[O-])O.[Na+]
InChIKey UASJMJKAMKICKL-UHFFFAOYSA-M
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0)?

Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0) is a white cryst...

Compound Q&A

How is Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0) typically synthesized?

Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate is typically synthesized by reactin...

Compound Q&A

What precautions should be taken when handling Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0)?

When handling Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...