Compound Q&A

How is Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0) typically synthesized?

Answer

Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate
Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate is typically synthesized by reacting 1,3-propanesulfonic acid with N,N-bis(2-hydroxyethyl)amine. The reaction is carried out in a water-miscible solvent such as ethanol, and the product is isolated by crystallization. The yield can be up to 85% with high selectivity. This compound is often used in various applications requiring precise pH control and complex formation.

About

English Name Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate
Molecular Formula C7H16NNaO6S
Molecular Weight 265.26 g/mol
SMILES C(CO)N(CCO)CC(CS(=O)(=O)[O-])O.[Na+]
InChIKey UASJMJKAMKICKL-UHFFFAOYSA-M
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0)?

Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0) is a white cryst...

Compound Q&A

What industries use Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0)?

Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0) is widely used i...

Compound Q&A

What precautions should be taken when handling Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0)?

When handling Sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonate (CAS: 102783-62-0), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...