Compound Q&A

How is Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) typically synthesized?

Answer

Ethyl 3-oxo-4-phenylbutanoate
Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) is typically synthesized through a condensation reaction between ethyl 3-oxobutanoate and phenylmagnesium bromide, followed by acid-catalyzed dehydration. Commonly used catalysts include sulfuric acid or hydrochloric acid. The yield is generally around 70-80%, and the reaction is selective for the desired product.

About

CAS No 718-08-1
English Name Ethyl 3-oxo-4-phenylbutanoate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CCOC(=O)CC(=O)CC1=CC=CC=C1
InChIKey BOZNWXQZCYZCSH-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1)?

Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) is a white crystalline solid with a molecular weight o...

Compound Q&A

What industries use Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1)?

Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1)?

When handling Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...