Compound Q&A

What are the physical and chemical properties of Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1)?

Answer

Ethyl 3-oxo-4-phenylbutanoate
Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) is a white crystalline solid with a molecular weight of approximately 224.31 g/mol. It is slightly soluble in water and readily soluble in organic solvents like ethanol and acetone. The compound is relatively stable, but it can undergo hydrolysis in the presence of strong acids or bases. It is also prone to oxidation under certain conditions.

About

CAS No 718-08-1
English Name Ethyl 3-oxo-4-phenylbutanoate
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CCOC(=O)CC(=O)CC1=CC=CC=C1
InChIKey BOZNWXQZCYZCSH-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) typically synthesized?

Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) is typically synthesized through a condensation reacti...

Compound Q&A

What industries use Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1)?

Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1) is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1)?

When handling Ethyl 3-oxo-4-phenylbutanoate (CAS: 718-08-1), it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...