Compound Q&A

How is 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4) typically synthesized?

Answer

2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate is typically synthesized through a multi-step process involving the formation of a piperidine ring, followed by the addition of an amino group and a carboxylate group. The reaction involves the use of a protecting group to control the stereochemistry, and strong bases like sodium hydride are often used. The yield is around 75-80%, and the reaction is carried out under anhydrous conditions to avoid unwanted side reactions.

About

English Name 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CN
InChIKey WPWXYQIMXTUMJB-SECBINFHSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4)?

2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate is a crystalline solid with a molec...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4)?

2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4)?

When handling 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...