Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4)?

Answer

2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate is a crystalline solid with a molecular weight of approximately 286.4 g/mol. It is slightly soluble in water but has good solubility in organic solvents like ethanol and acetone. The compound is reactive towards nucleophiles and is typically stable at room temperature but may degrade under basic conditions. It exhibits basic behavior due to the aminomethyl group.

About

English Name 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CN
InChIKey WPWXYQIMXTUMJB-SECBINFHSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4) typically synthesized?

2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate is typically synthesized through a ...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4)?

2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate (CAS: 140645-23-4)?

When handling 2-Methyl-2-propanyl (3R)-3-(aminomethyl)-1-piperidinecarboxylate, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...