Compound Q&A

What industries use adamantane-1-carbonyl chloride (CAS: 2094-72-6)?

Answer

adamantane-1-carbonyl chloride
Adamantane-1-carbonyl chloride is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for modifying polymers, and in the semiconductor industry for manufacturing electronic materials and devices. It is also used in the production of sensors and other specialized chemical compounds.

About

CAS No 2094-72-6
English Name adamantane-1-carbonyl chloride
Molecular Formula C11H15ClO
Molecular Weight 198.69 g/mol
SMILES C1C2CC3CC1CC(C2)(C3)C(=O)Cl
InChIKey MIBQYWIOHFTKHD-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of adamantane-1-carbonyl chloride (CAS: 2094-72-6)?

Adamantane-1-carbonyl chloride is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

How is adamantane-1-carbonyl chloride (CAS: 2094-72-6) typically synthesized?

Adamantane-1-carbonyl chloride is typically synthesized by treating adamantane with thionyl chloride...

Compound Q&A

What precautions should be taken when handling adamantane-1-carbonyl chloride (CAS: 2094-72-6)?

When handling adamantane-1-carbonyl chloride, it is essential to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...