Compound Q&A

How is adamantane-1-carbonyl chloride (CAS: 2094-72-6) typically synthesized?

Answer

adamantane-1-carbonyl chloride
Adamantane-1-carbonyl chloride is typically synthesized by treating adamantane with thionyl chloride in the presence of a catalytic amount of anhydrous aluminum chloride. The reaction is carried out under anhydrous conditions to prevent hydrolysis of the intermediate chloroformate.

About

CAS No 2094-72-6
English Name adamantane-1-carbonyl chloride
Molecular Formula C11H15ClO
Molecular Weight 198.69 g/mol
SMILES C1C2CC3CC1CC(C2)(C3)C(=O)Cl
InChIKey MIBQYWIOHFTKHD-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of adamantane-1-carbonyl chloride (CAS: 2094-72-6)?

Adamantane-1-carbonyl chloride is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use adamantane-1-carbonyl chloride (CAS: 2094-72-6)?

Adamantane-1-carbonyl chloride is used in the pharmaceutical industry for the synthesis of certain d...

Compound Q&A

What precautions should be taken when handling adamantane-1-carbonyl chloride (CAS: 2094-72-6)?

When handling adamantane-1-carbonyl chloride, it is essential to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...