Compound Q&A

What industries use 4”-O-Glucosylvitexin (CAS: 76135-82-5)?

Answer

4”-O-Glucosylvitexin
4”-O-Glucosylvitexin is used in the pharmaceutical industry for its potential medicinal properties, particularly in anti-inflammatory and antioxidant applications. It is also explored in the food industry for its potential health benefits and in natural product chemistry for structural analysis.

About

CAS No 76135-82-5
English Name 4”-O-Glucosylvitexin
Molecular Formula C27H32O17
Molecular Weight 610.52 g/mol
SMILES O=C1C=C(C2=CC=C(O)C=C2)OC3=C1C(O)=CC(O)=C3O[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O5)[C@@H](O)[C@H](O)[C@@H](CO)O4
InChIKey FHPGRJSWCJSVEN-OWNIHXIWSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4”-O-Glucosylvitexin (CAS: 76135-82-5)?

4”-O-Glucosylvitexin is a crystalline compound with a molecular weight of approximately 606.4 g/mol....

Compound Q&A

How is 4”-O-Glucosylvitexin (CAS: 76135-82-5) typically synthesized?

4”-O-Glucosylvitexin is typically synthesized through glycosylation reactions, where a glucosyl grou...

Compound Q&A

What precautions should be taken when handling 4”-O-Glucosylvitexin (CAS: 76135-82-5)?

When handling 4”-O-Glucosylvitexin, it is important to wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...