Compound Q&A

What are the physical and chemical properties of 4”-O-Glucosylvitexin (CAS: 76135-82-5)?

Answer

4”-O-Glucosylvitexin
4”-O-Glucosylvitexin is a crystalline compound with a molecular weight of approximately 606.4 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and ethanol. Chemically, it exhibits limited reactivity, primarily in hydrolysis and glycosidic bond cleavage reactions.

About

CAS No 76135-82-5
English Name 4”-O-Glucosylvitexin
Molecular Formula C27H32O17
Molecular Weight 610.52 g/mol
SMILES O=C1C=C(C2=CC=C(O)C=C2)OC3=C1C(O)=CC(O)=C3O[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O5)[C@@H](O)[C@H](O)[C@@H](CO)O4
InChIKey FHPGRJSWCJSVEN-OWNIHXIWSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 4”-O-Glucosylvitexin (CAS: 76135-82-5) typically synthesized?

4”-O-Glucosylvitexin is typically synthesized through glycosylation reactions, where a glucosyl grou...

Compound Q&A

What industries use 4”-O-Glucosylvitexin (CAS: 76135-82-5)?

4”-O-Glucosylvitexin is used in the pharmaceutical industry for its potential medicinal properties, ...

Compound Q&A

What precautions should be taken when handling 4”-O-Glucosylvitexin (CAS: 76135-82-5)?

When handling 4”-O-Glucosylvitexin, it is important to wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...