Compound Q&A

What are the physical and chemical properties of Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4)?

Answer

Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate
Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4) is a colorless to white crystalline solid with a molecular weight of approximately 321.02 g/mol. It has low water solubility and is soluble in organic solvents like acetone and dichloromethane. It is moderately reactive, particularly towards nucleophiles and bases. This compound is stable under normal conditions but should be stored in a tightly sealed container to prevent exposure to moisture and light.

About

English Name Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate
Molecular Formula C11H8ClF3O3
Molecular Weight 280.63 g/mol
SMILES CCOC(=O)CC(=O)C1=CC(=C(C(=C1F)Cl)F)F
InChIKey LZMXLCPYJNRWNQ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4) typically synthesized?

Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4) is synthesized from 3-ch...

Compound Q&A

What industries use Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4)?

Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4) is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4)?

When handling Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate (CAS: 101987-86-4), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...