Compound Q&A

How is Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) typically synthesized?

Answer

Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-)
Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) is typically synthesized by the reaction of triphenylmethanol with tetrakis(pentafluorophenyl)borate in the presence of a base such as potassium carbonate. The reaction proceeds via a transformation of the alcohol to the corresponding borate ester, followed by a substitution reaction to form the final product.

About

English Name Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-)
Molecular Formula C43H15BF20
Molecular Weight 922.4 g/mol
SMILES [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C1=CC=C(C=C1)[C+](C2=CC=CC=C2)C3=CC=CC=C3
InChIKey TZOSNOQHGGONMD-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2)?

Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) is a white crystalline s...

Compound Q&A

What industries use Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2)?

Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) is used in pharmaceutica...

Compound Q&A

What precautions should be taken when handling Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2)?

When handling Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2), it is rec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...