Compound Q&A

What are the physical and chemical properties of Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2)?

Answer

Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-)
Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) is a white crystalline solid with a high molecular weight. It has low solubility in common organic solvents but good solubility in polar aprotic solvents. This compound is known for its chemical stability and low reactivity, making it suitable for various applications in organic synthesis and material science.

About

English Name Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-)
Molecular Formula C43H15BF20
Molecular Weight 922.4 g/mol
SMILES [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C1=CC=C(C=C1)[C+](C2=CC=CC=C2)C3=CC=CC=C3
InChIKey TZOSNOQHGGONMD-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) typically synthesized?

Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) is typically synthesized...

Compound Q&A

What industries use Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2)?

Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2) is used in pharmaceutica...

Compound Q&A

What precautions should be taken when handling Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2)?

When handling Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) (CAS: 136040-19-2), it is rec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...