Compound Q&A

What industries use 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0)?

Answer

3-Oxoolean-12-en-28-oic acid
3-Oxoolean-12-en-28-oic acid is used in the pharmaceutical industry for its biological activity, particularly in the development of potential anti-inflammatory and anticancer drugs. It is also used in the polymer industry as a precursor for polymer synthesis and in the production of functionalized polymers. Additionally, it has applications in the sensor technology and semiconductor industries.

About

CAS No 17990-42-0
English Name 3-Oxoolean-12-en-28-oic acid
Molecular Formula C30H46O3
Molecular Weight 454.7 g/mol
SMILES C[C@]1(C[C@@H]2[C@@](CC[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)[C@]5(C)C)C)C)C)(CC1)C(=O)O)C
InChIKey FMIMFCRXYXVFTA-FUAOEXFOSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0)?

3-Oxoolean-12-en-28-oic acid is a white to off-white crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0) typically synthesized?

3-Oxoolean-12-en-28-oic acid is typically synthesized through the oxidation of 3-oxoolean-12-ene-28-...

Compound Q&A

What precautions should be taken when handling 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0)?

When handling 3-Oxoolean-12-en-28-oic acid, it is essential to use personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...