Compound Q&A

How is 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0) typically synthesized?

Answer

3-Oxoolean-12-en-28-oic acid
3-Oxoolean-12-en-28-oic acid is typically synthesized through the oxidation of 3-oxoolean-12-ene-28-aldehyde followed by acid catalyzed condensation. The synthesis often involves the use of chromic acid or potassium permanganate for oxidation, and hydrochloric acid for the condensation step. The overall yield is moderate to good, and the selectivity is high.

About

CAS No 17990-42-0
English Name 3-Oxoolean-12-en-28-oic acid
Molecular Formula C30H46O3
Molecular Weight 454.7 g/mol
SMILES C[C@]1(C[C@@H]2[C@@](CC[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)[C@]5(C)C)C)C)C)(CC1)C(=O)O)C
InChIKey FMIMFCRXYXVFTA-FUAOEXFOSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0)?

3-Oxoolean-12-en-28-oic acid is a white to off-white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0)?

3-Oxoolean-12-en-28-oic acid is used in the pharmaceutical industry for its biological activity, par...

Compound Q&A

What precautions should be taken when handling 3-Oxoolean-12-en-28-oic acid (CAS: 17990-42-0)?

When handling 3-Oxoolean-12-en-28-oic acid, it is essential to use personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...