Compound Q&A

What precautions should be taken when handling Fmoc-thr(tbu)-ol (CAS: 189337-28-8)?

Answer

Fmoc-thr(tbu)-ol
When handling Fmoc-thr(tbu)-ol (CAS: 189337-28-8), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be cleaned up using appropriate absorbents, and the area should be thoroughly washed down. Always refer to the safety data sheet (SDS) for detailed handling instructions and emergency protocols.

About

English Name Fmoc-thr(tbu)-ol
Molecular Formula C23H29NO4
Molecular Weight 383.49 g/mol
SMILES CC(C(CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C
InChIKey LBVPBNDGSCZOTB-QVKFZJNVSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-thr(tbu)-ol (CAS: 189337-28-8)?

Fmoc-thr(tbu)-ol (CAS: 189337-28-8) is a white crystalline powder with a molecular weight of approxi...

Compound Q&A

How is Fmoc-thr(tbu)-ol (CAS: 189337-28-8) typically synthesized?

Fmoc-thr(tbu)-ol is typically synthesized by the saponification of Fmoc-Thr(tert-butyloxycarbonyl)-b...

Compound Q&A

What industries use Fmoc-thr(tbu)-ol (CAS: 189337-28-8)?

Fmoc-thr(tbu)-ol (CAS: 189337-28-8) is primarily used in the pharmaceutical and chemical industries....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...