Compound Q&A

What industries use 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5)?

Answer

3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (1:1)
3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride is widely used in the pharmaceutical industry for the synthesis of drug candidates. It is also utilized in the polymer industry for the development of specialized polymers and in the field of sensors for its unique optical properties. Additionally, it is used in semiconductor technology as a precursor in the production of certain materials.

About

CAS No 5409-58-5
English Name 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (1:1)
Molecular Formula C15H18ClNO
Molecular Weight 263.77 g/mol
SMILES CN(C)CCC(=O)C1=CC=CC2=CC=CC=C21.Cl
InChIKey GUTDWEKYWTXJGD-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5)?

3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride is a crystalline compound with a molecula...

Compound Q&A

How is 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5) typically synthesized?

3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride is typically synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5)?

When handling 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...