Compound Q&A

What are the physical and chemical properties of 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5)?

Answer

3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (1:1)
3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride is a crystalline compound with a molecular weight of approximately 316.8 g/mol. It is soluble in water and organic solvents. The compound is known for its stability and low reactivity under normal conditions. It is a key intermediate in the synthesis of various pharmaceuticals and organic compounds.

About

CAS No 5409-58-5
English Name 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (1:1)
Molecular Formula C15H18ClNO
Molecular Weight 263.77 g/mol
SMILES CN(C)CCC(=O)C1=CC=CC2=CC=CC=C21.Cl
InChIKey GUTDWEKYWTXJGD-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5) typically synthesized?

3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride is typically synthesized through a multi-...

Compound Q&A

What industries use 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5)?

3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride is widely used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride (CAS: 5409-58-5)?

When handling 3-(Dimethylamino)-1-(1-naphthyl)-1-propanone hydrochloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...