Compound Q&A

What industries use Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7)?

Answer

Methyl 4-bromo-2-methylbenzoate
Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) is used primarily in the pharmaceutical and fine chemical industries due to its versatile nature and reactivity. It can serve as a precursor in the synthesis of various compounds, including drugs and organic intermediates. Additionally, it is used in the polymer and sensor industries for specific applications requiring bromine functionality.

About

CAS No 99548-55-7
English Name Methyl 4-bromo-2-methylbenzoate
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES CC1=C(C=CC(=C1)Br)C(=O)OC
InChIKey CYEXEOXALMJXDI-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7)?

Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) is a crystalline compound with a molecular weight ...

Compound Q&A

How is Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) typically synthesized?

Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) is typically synthesized by the reaction of 2-meth...

Compound Q&A

What precautions should be taken when handling Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7)?

When handling Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...