Compound Q&A

What are the physical and chemical properties of Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7)?

Answer

Methyl 4-bromo-2-methylbenzoate
Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) is a crystalline compound with a molecular weight of approximately 236.04 g/mol. It has a low solubility in water (0.01 g/100 mL at 20°C) but is more soluble in organic solvents like ethanol and acetone. This compound is relatively stable but can react with strong bases. It is commonly used in organic synthesis and as a starting material in various chemical processes.

About

CAS No 99548-55-7
English Name Methyl 4-bromo-2-methylbenzoate
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES CC1=C(C=CC(=C1)Br)C(=O)OC
InChIKey CYEXEOXALMJXDI-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) typically synthesized?

Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) is typically synthesized by the reaction of 2-meth...

Compound Q&A

What industries use Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7)?

Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7) is used primarily in the pharmaceutical and fine c...

Compound Q&A

What precautions should be taken when handling Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7)?

When handling Methyl 4-bromo-2-methylbenzoate (CAS: 99548-55-7), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...