Compound Q&A

What precautions should be taken when handling 5-Bromouridine (CAS: 957-75-5)?

Answer

5-Bromouridine
When handling 5-Bromouridine (CAS: 957-75-5), it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Store it in a cool, dry place away from direct sunlight. If a spill occurs, it should be handled in a fume hood using proper clean-up techniques. Always refer to the safety data sheet (SDS) for detailed safety information.

About

CAS No 957-75-5
English Name 5-Bromouridine
Molecular Formula C9H11BrN2O6
Molecular Weight 323.1 g/mol
SMILES C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)Br
InChIKey AGFIRQJZCNVMCW-UAKXSSHOSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromouridine (CAS: 957-75-5)?

5-Bromouridine (CAS: 957-75-5) is a crystalline solid with a molecular weight of approximately 243.0...

Compound Q&A

How is 5-Bromouridine (CAS: 957-75-5) typically synthesized?

5-Bromouridine is typically synthesized by bromination of uridine. The reaction is carried out using...

Compound Q&A

What industries use 5-Bromouridine (CAS: 957-75-5)?

5-Bromouridine (CAS: 957-75-5) is utilized in various industries, including pharmaceuticals for drug...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...