Compound Q&A

How is Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0) typically synthesized?

Answer

Methyl 2,6-dichloro-4-pyrimidinecarboxylate
Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0) is typically synthesized via the condensation of methyl acetoacetate with 2,6-dichloropyrimidine, using a base like sodium hydroxide. The reaction is performed in an aprotic solvent such as dimethylformamide (DMF). The yield is around 70-80% with high selectivity.

About

CAS No 6299-85-0
English Name Methyl 2,6-dichloro-4-pyrimidinecarboxylate
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.02 g/mol
SMILES COC(=O)C1=CC(=NC(=N1)Cl)Cl
InChIKey DQNQNLWKAGZNIT-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0)?

Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0) is a white crystalline solid with a mol...

Compound Q&A

What industries use Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0)?

Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0)?

When handling Methyl 2,6-dichloro-4-pyrimidinecarboxylate (CAS: 6299-85-0), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...