Compound Q&A

How is Titanyl phthalocyanine (CAS: 26201-32-1) typically synthesized?

Answer

Titanyl phthalocyanine
Titanyl phthalocyanine (CAS: 26201-32-1) is typically synthesized through the amidation of phthalocyanine with titanium(IV) chloride. Common solvents include dichloromethane, and the process involves heating under reflux for several hours. The reaction is selective and yields a high percentage of the product.

About

CAS No 26201-32-1
English Name Titanyl phthalocyanine
Molecular Formula C32H22N8OTi
Molecular Weight 561.41 g/mol
EINECS 419-970-5
SMILES [Ti]C1=CC=CC(C2=N3)=C1C(N2)=NC4=NC(C5=CC=CC=C54)=NC(N6)=C7C=CC=CC7=C6N=C8C9=CC=CC=C9C3=N8
InChIKey QJVLCISWTWVWEE-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Titanyl phthalocyanine (CAS: 26201-32-1)?

Titanyl phthalocyanine (CAS: 26201-32-1) is a blue crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use Titanyl phthalocyanine (CAS: 26201-32-1)?

Titanyl phthalocyanine (CAS: 26201-32-1) is widely used in the dye and pigment industry for its vibr...

Compound Q&A

What precautions should be taken when handling Titanyl phthalocyanine (CAS: 26201-32-1)?

When handling Titanyl phthalocyanine (CAS: 26201-32-1), wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...