Compound Q&A

What are the physical and chemical properties of Titanyl phthalocyanine (CAS: 26201-32-1)?

Answer

Titanyl phthalocyanine
Titanyl phthalocyanine (CAS: 26201-32-1) is a blue crystalline solid with a molecular weight of approximately 600 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is known for its high stability and photophysical properties, making it reactive under certain conditions.

About

CAS No 26201-32-1
English Name Titanyl phthalocyanine
Molecular Formula C32H22N8OTi
Molecular Weight 561.41 g/mol
EINECS 419-970-5
SMILES [Ti]C1=CC=CC(C2=N3)=C1C(N2)=NC4=NC(C5=CC=CC=C54)=NC(N6)=C7C=CC=CC7=C6N=C8C9=CC=CC=C9C3=N8
InChIKey QJVLCISWTWVWEE-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Titanyl phthalocyanine (CAS: 26201-32-1) typically synthesized?

Titanyl phthalocyanine (CAS: 26201-32-1) is typically synthesized through the amidation of phthalocy...

Compound Q&A

What industries use Titanyl phthalocyanine (CAS: 26201-32-1)?

Titanyl phthalocyanine (CAS: 26201-32-1) is widely used in the dye and pigment industry for its vibr...

Compound Q&A

What precautions should be taken when handling Titanyl phthalocyanine (CAS: 26201-32-1)?

When handling Titanyl phthalocyanine (CAS: 26201-32-1), wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...