Compound Q&A

How should 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) be stored?

Answer

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid
1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) should be stored in a tightly closed container in a cool, dry place, away from direct sunlight and heat sources. Maintain a temperature below 25°C and avoid exposure to moisture and humidity to ensure stability and prevent degradation of the compound. Proper storage conditions are crucial to maintain its quality and efficacy.

About

CAS No 10314-98-4
English Name 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid
Molecular Formula C14H17NO4
Molecular Weight 263.29 g/mol
SMILES C1CN(CCC1C(=O)O)C(=O)OCC2=CC=CC=C2
InChIKey URTPNQRAHXRPMP-UHFFFAOYSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What is 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4)?

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) is a cyclic compound with a pi...

Compound Q&A

What are the main uses of 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4)?

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) is primarily used as an interm...

Compound Q&A

Is 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) safe?

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) is generally considered safe w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...