Compound Q&A

What are the main uses of 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4)?

Answer

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid
1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) is primarily used as an intermediate in the pharmaceutical industry. It serves as a starting material for the synthesis of various drugs, particularly those requiring a piperidine structure. Additionally, it is used in the research and development of new chemical entities in drug discovery processes.

About

CAS No 10314-98-4
English Name 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid
Molecular Formula C14H17NO4
Molecular Weight 263.29 g/mol
SMILES C1CN(CCC1C(=O)O)C(=O)OCC2=CC=CC=C2
InChIKey URTPNQRAHXRPMP-UHFFFAOYSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What is 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4)?

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) is a cyclic compound with a pi...

Compound Q&A

Is 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) safe?

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) is generally considered safe w...

Compound Q&A

How should 1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) be stored?

1-[(Benzyloxy)carbonyl]-4-piperidinecarboxylic acid (CAS: 10314-98-4) should be stored in a tightly ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...