Compound Q&A

What are the main uses of Azure B (CAS: 531-55-5)?

Answer

Azure B (Technical Grade)
Azure B is primarily used in the textile industry for dyeing fabrics, especially cotton and wool. In the pharmaceutical industry, it serves as an intermediate in the synthesis of other compounds and is also used for color verification in drug manufacturing. It is also sometimes used in research for its distinctive color properties.

About

CAS No 531-55-5
English Name Azure B (Technical Grade)
Molecular Formula C15H16ClN3S
Molecular Weight 305.8 g/mol
SMILES CNC1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-]
InChIKey DNDJEIWCTMMZBX-UHFFFAOYSA-N
Last Updated: 2025-09-24 16:40

Related Q&A

Compound Q&A

What is Azure B (CAS: 531-55-5)?

Azure B, also known as 2,2',4,4',5,5'-Hexamethyltriphenylmethanol, is a blue dye with the CAS number...

Compound Q&A

Is Azure B (CAS: 531-55-5) safe?

Azure B is generally considered safe for industrial use when proper protective measures are taken. H...

Compound Q&A

How should Azure B (CAS: 531-55-5) be stored?

Azure B should be stored in a cool, dry place away from direct sunlight and heat sources to maintain...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...