Compound Q&A

What is Azure B (CAS: 531-55-5)?

Answer

Azure B (Technical Grade)
Azure B, also known as 2,2',4,4',5,5'-Hexamethyltriphenylmethanol, is a blue dye with the CAS number 531-55-5. It is commonly used in the textile and pharmaceutical industries for its vibrant color and stability.

About

CAS No 531-55-5
English Name Azure B (Technical Grade)
Molecular Formula C15H16ClN3S
Molecular Weight 305.8 g/mol
SMILES CNC1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-]
InChIKey DNDJEIWCTMMZBX-UHFFFAOYSA-N
Last Updated: 2025-09-24 16:40

Related Q&A

Compound Q&A

What are the main uses of Azure B (CAS: 531-55-5)?

Azure B is primarily used in the textile industry for dyeing fabrics, especially cotton and wool. In...

Compound Q&A

Is Azure B (CAS: 531-55-5) safe?

Azure B is generally considered safe for industrial use when proper protective measures are taken. H...

Compound Q&A

How should Azure B (CAS: 531-55-5) be stored?

Azure B should be stored in a cool, dry place away from direct sunlight and heat sources to maintain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...