Compound Q&A

How should 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) be stored?

Answer

4-Chloro-3-sulfamoylbenzoyl chloride
4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Store it at a temperature below 25°C (77°F) to maintain its stability and reactivity. Avoid contact with water and incompatible materials.

About

CAS No 70049-77-3
English Name 4-Chloro-3-sulfamoylbenzoyl chloride
Molecular Formula C7H5Cl2NO3S
Molecular Weight 254.09 g/mol
SMILES C1=CC(=C(C=C1C(=O)Cl)S(=O)(=O)N)Cl
InChIKey SCYSJFKWFQZRJW-UHFFFAOYSA-N
Last Updated: 2025-09-24 08:06

Related Q&A

Compound Q&A

What is 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3)?

4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) is an organic compound with a molecular formu...

Compound Q&A

What are the main uses of 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3)?

4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) is primarily used in the synthesis of pharmac...

Compound Q&A

Is 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) safe?

4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) is not considered safe for general use withou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...