Compound Q&A

Is 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) safe?

Answer

4-Chloro-3-sulfamoylbenzoyl chloride
4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) is not considered safe for general use without appropriate handling and protective measures. It requires proper ventilation and gloves to handle. Exposure to this compound can cause irritation to the skin and eyes, and inhalation may lead to respiratory issues. Adequate safety precautions and personal protective equipment are essential.

About

CAS No 70049-77-3
English Name 4-Chloro-3-sulfamoylbenzoyl chloride
Molecular Formula C7H5Cl2NO3S
Molecular Weight 254.09 g/mol
SMILES C1=CC(=C(C=C1C(=O)Cl)S(=O)(=O)N)Cl
InChIKey SCYSJFKWFQZRJW-UHFFFAOYSA-N
Last Updated: 2025-09-24 08:06

Related Q&A

Compound Q&A

What is 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3)?

4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) is an organic compound with a molecular formu...

Compound Q&A

What are the main uses of 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3)?

4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) is primarily used in the synthesis of pharmac...

Compound Q&A

How should 4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) be stored?

4-Chloro-3-sulfamoylbenzoyl chloride (CAS: 70049-77-3) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...