Compound Q&A

What are the main uses of 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2)?

Answer

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol
2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) is primarily used in pharmaceuticals for the synthesis of certain drugs. It also finds applications in the chemical industry, particularly in the production of dyes and pigments. Additionally, it is used in research for its potential biological activities.

About

CAS No 68527-74-2
English Name 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES CC1COC(O1)c2ccc(c(c2)OC)O
InChIKey RFGCVZIIIHRESZ-UHFFFAOYSA-N
Last Updated: 2025-09-24 08:06

Related Q&A

Compound Q&A

What is 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2)?

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) is an organo-phenolic compound. It ...

Compound Q&A

Is 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) safe?

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) is generally considered safe when h...

Compound Q&A

How should 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) be stored?

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...