Compound Q&A

What is 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2)?

Answer

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol
2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) is an organo-phenolic compound. It is a colorless solid with a molecular formula of C12H16O4. This compound is characterized by its aromatic structure and is used in various applications due to its unique chemical properties.

About

CAS No 68527-74-2
English Name 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES CC1COC(O1)c2ccc(c(c2)OC)O
InChIKey RFGCVZIIIHRESZ-UHFFFAOYSA-N
Last Updated: 2025-09-24 08:06

Related Q&A

Compound Q&A

What are the main uses of 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2)?

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) is primarily used in pharmaceutical...

Compound Q&A

Is 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) safe?

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) is generally considered safe when h...

Compound Q&A

How should 2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) be stored?

2-Methoxy-4-(4-methyl-1,3-dioxolan-2-yl)phenol (CAS: 68527-74-2) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...