Compound Q&A

What is the market or research trend for Kukoamine B (CAS: 164991-67-7)?

Answer

Kukoamine B
The market and research trend for Kukoamine B (CAS: 164991-67-7) indicate increasing interest in its potential therapeutic applications, particularly in anti-inflammatory and cardiovascular research. Recent studies focus on its chemical structure, biological activities, and potential for drug development. The compound is also being explored for its role in natural product chemistry and as a lead compound for new drug discovery.

About

English Name Kukoamine B
Molecular Formula C28H42N4O6
Molecular Weight 530.67 g/mol
SMILES C1=CC(=C(C=C1CCC(=O)NCCCNCCCCN(CCCN)C(=O)CCC2=CC(=C(C=C2)O)O)O)O
InChIKey IWRAOCFRRTWUDF-UHFFFAOYSA-N
Last Updated: 2025-09-23 22:54

Related Q&A

Compound Q&A

What regulatory guidelines apply to Kukoamine B (CAS: 164991-67-7)?

Kukoamine B (CAS: 164991-67-7) should comply with the Global Harmonized System (GHS) for classificat...

Compound Q&A

Are there alternatives to Kukoamine B (CAS: 164991-67-7) in synthesis?

There are alternatives to Kukoamine B (CAS: 164991-67-7) in synthesis, such as other alkaloids from ...

Compound Q&A

How should waste containing Kukoamine B (CAS: 164991-67-7) be handled?

Waste containing Kukoamine B (CAS: 164991-67-7) should be collected in appropriate containers, label...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...