Compound Q&A

Are there alternatives to Kukoamine B (CAS: 164991-67-7) in synthesis?

Answer

Kukoamine B
There are alternatives to Kukoamine B (CAS: 164991-67-7) in synthesis, such as other alkaloids from the same plant family or synthetic analogs. Common alternatives include isomers like Kukoamine A and other related compounds. These alternatives can serve similar biological functions and are often used as substitutes in research and pharmaceutical applications.

About

English Name Kukoamine B
Molecular Formula C28H42N4O6
Molecular Weight 530.67 g/mol
SMILES C1=CC(=C(C=C1CCC(=O)NCCCNCCCCN(CCCN)C(=O)CCC2=CC(=C(C=C2)O)O)O)O
InChIKey IWRAOCFRRTWUDF-UHFFFAOYSA-N
Last Updated: 2025-09-23 22:54

Related Q&A

Compound Q&A

What regulatory guidelines apply to Kukoamine B (CAS: 164991-67-7)?

Kukoamine B (CAS: 164991-67-7) should comply with the Global Harmonized System (GHS) for classificat...

Compound Q&A

What is the market or research trend for Kukoamine B (CAS: 164991-67-7)?

The market and research trend for Kukoamine B (CAS: 164991-67-7) indicate increasing interest in its...

Compound Q&A

How should waste containing Kukoamine B (CAS: 164991-67-7) be handled?

Waste containing Kukoamine B (CAS: 164991-67-7) should be collected in appropriate containers, label...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...