Compound Q&A

How is Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) typically synthesized?

Answer

Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate]
Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) can be synthesized by the reaction of copper(II) acetate with 3-(3-ethylcyclopentyl)propanoic acid in the presence of an appropriate base. The reaction is typically carried out at room temperature, and the product is isolated by precipitation and filtration. The yield and selectivity of the reaction can be optimized by adjusting the reaction conditions and using appropriate catalysts.

About

CAS No 1338-02-9
English Name Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate]
Molecular Formula C20H34CuO4
Molecular Weight 405.9 g/mol
EINECS 215-657-0
SMILES CCC1CCC(C1)CCC(=O)[O-].CCC1CCC(C1)CCC(=O)[O-].[Cu+2]
InChIKey CLMLGYOTQMAXKL-UHFFFAOYSA-L
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9)?

Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) is a copper complex with a molecul...

Compound Q&A

What industries use Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9)?

Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) has applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9)?

When handling Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9), ensure proper venti...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...