Compound Q&A

What are the physical and chemical properties of Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9)?

Answer

Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate]
Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) is a copper complex with a molecular weight of approximately 424.4 g/mol. It exists in a crystalline form with a high melting point and low solubility in water. It exhibits good reactivity towards various nucleophiles and can form coordination complexes with other metal ions. This compound is typically used as a catalyst in organic synthesis and as a ligand in coordination chemistry.

About

CAS No 1338-02-9
English Name Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate]
Molecular Formula C20H34CuO4
Molecular Weight 405.9 g/mol
EINECS 215-657-0
SMILES CCC1CCC(C1)CCC(=O)[O-].CCC1CCC(C1)CCC(=O)[O-].[Cu+2]
InChIKey CLMLGYOTQMAXKL-UHFFFAOYSA-L
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) typically synthesized?

Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) can be synthesized by the reaction...

Compound Q&A

What industries use Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9)?

Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9) has applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9)?

When handling Copper(2+) bis[3-(3-ethylcyclopentyl)propanoate] (CAS: 1338-02-9), ensure proper venti...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...