Compound Q&A

What are the physical and chemical properties of Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6)?

Answer

Methyl 5-chloro-2-nitrobenzoate
Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6) is a solid with a crystalline form. Its molecular weight is approximately 227.58 g/mol. It has a low solubility in water but is soluble in common organic solvents like dichloromethane and acetonitrile. The compound is moderately reactive, particularly towards nucleophiles. It is stable under normal conditions but should be stored away from moisture and heat to prevent degradation.

About

CAS No 51282-49-6
English Name Methyl 5-chloro-2-nitrobenzoate
Molecular Formula C8H6ClNO4
Molecular Weight 215.59 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Cl)[N+](=O)[O-]
InChIKey JGBJHRKCUKTQOE-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6) typically synthesized?

Methyl 5-chloro-2-nitrobenzoate is typically synthesized via the nitration of methyl 2-chlorobenzoat...

Compound Q&A

What industries use Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6)?

Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6) is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6)?

When handling Methyl 5-chloro-2-nitrobenzoate (CAS: 51282-49-6), proper personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...