Compound Q&A

How is Hosenkoside A (CAS: 156791-82-1) typically synthesized?

Answer

Hosenkoside A
Hosenkoside A is usually synthesized through a multi-step process involving organic transformations such as esterification, etherification, and hydrolysis. Common catalysts include acids and bases. The synthesis typically achieves high yields and good selectivity, with key intermediates identified by spectroscopic methods such as NMR and mass spectrometry.

About

English Name Hosenkoside A
Molecular Formula C48H82O20
Molecular Weight 979.15 g/mol
SMILES OC[C@H]1O[C@@H](OC[C@]2(C)[C@H](CC[C@]3([C@H]2CC[C@@]2([C@@H]3CC[C@H]3[C@@]2(C)CC[C@]2([C@@H]3O)CC[C@H](OC2)[C@H](CO)C)C)C)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey JUKFJOYCFLIWIA-MDQYKXRHSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hosenkoside A (CAS: 156791-82-1)?

Hosenkoside A is a crystalline compound with a molecular weight of approximately 894.87 g/mol. It ha...

Compound Q&A

What industries use Hosenkoside A (CAS: 156791-82-1)?

Hosenkoside A (CAS: 156791-82-1) is primarily used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling Hosenkoside A (CAS: 156791-82-1)?

When handling Hosenkoside A (CAS: 156791-82-1), appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...