Compound Q&A

What are the physical and chemical properties of Hosenkoside A (CAS: 156791-82-1)?

Answer

Hosenkoside A
Hosenkoside A is a crystalline compound with a molecular weight of approximately 894.87 g/mol. It has a solubility of about 1 mg/mL in water and is practically insoluble in most organic solvents. Chemically, it is highly reactive towards hydrolysis and easily undergoes oxidation reactions.

About

English Name Hosenkoside A
Molecular Formula C48H82O20
Molecular Weight 979.15 g/mol
SMILES OC[C@H]1O[C@@H](OC[C@]2(C)[C@H](CC[C@]3([C@H]2CC[C@@]2([C@@H]3CC[C@H]3[C@@]2(C)CC[C@]2([C@@H]3O)CC[C@H](OC2)[C@H](CO)C)C)C)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey JUKFJOYCFLIWIA-MDQYKXRHSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Hosenkoside A (CAS: 156791-82-1) typically synthesized?

Hosenkoside A is usually synthesized through a multi-step process involving organic transformations ...

Compound Q&A

What industries use Hosenkoside A (CAS: 156791-82-1)?

Hosenkoside A (CAS: 156791-82-1) is primarily used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling Hosenkoside A (CAS: 156791-82-1)?

When handling Hosenkoside A (CAS: 156791-82-1), appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...