Compound Q&A

What industries use Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2)?

Answer

Ethyl 2-oxo-4-phenylbutyrate (>90%)
Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) is widely used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry as a monomer for the production of specialty polymers. Additionally, it finds applications in the sensor technology sector due to its reactivity and is sometimes employed in semiconductor manufacturing processes.

About

CAS No 64920-29-2
English Name Ethyl 2-oxo-4-phenylbutyrate (>90%)
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CCOC(=O)C(=O)CCC1=CC=CC=C1
InChIKey STPXIOGYOLJXMZ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2)?

Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) typically synthesized?

Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) is typically synthesized via a multistep process, sta...

Compound Q&A

What precautions should be taken when handling Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2)?

When handling Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...