Compound Q&A

How is Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) typically synthesized?

Answer

Ethyl 2-oxo-4-phenylbutyrate (>90%)
Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) is typically synthesized via a multistep process, starting with phenylacetic acid and acetic anhydride. A suitable catalyst, such as p-toluenesulfonic acid, is used to facilitate the esterification reaction. The crude product is then purified using column chromatography or recrystallization. Yield can reach up to 85% with good selectivity.

About

CAS No 64920-29-2
English Name Ethyl 2-oxo-4-phenylbutyrate (>90%)
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CCOC(=O)C(=O)CCC1=CC=CC=C1
InChIKey STPXIOGYOLJXMZ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2)?

Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2)?

Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2) is widely used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2)?

When handling Ethyl 2-oxo-4-phenylbutyrate (CAS: 64920-29-2), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...