Compound Q&A

What are the physical and chemical properties of 2-(4-Chlorobenzyl)-1H-benzimidazole (CAS: 5468-66-6)?

Answer

2-(4-Chlorobenzyl)-1H-benzimidazole
2-(4-Chlorobenzyl)-1H-benzimidazole is a white or off-white crystalline solid with a molecular weight of approximately 268.02 g/mol. It has poor water solubility but is soluble in organic solvents such as methanol and acetonitrile. The compound is moderately reactive and can undergo substitution reactions. It is stable under normal storage conditions but should be handled in a fume hood to avoid inhalation exposure.

About

CAS No 5468-66-6
English Name 2-(4-Chlorobenzyl)-1H-benzimidazole
Molecular Formula C14H11ClN2
Molecular Weight 242.71 g/mol
SMILES C1=CC=C2C(=C1)NC(=N2)CC3=CC=C(C=C3)Cl
InChIKey COGUOPIIFAMLES-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 2-(4-Chlorobenzyl)-1H-benzimidazole (CAS: 5468-66-6) typically synthesized?

2-(4-Chlorobenzyl)-1H-benzimidazole is typically synthesized by the condensation of 4-chlorobenzylam...

Compound Q&A

What industries use 2-(4-Chlorobenzyl)-1H-benzimidazole (CAS: 5468-66-6)?

2-(4-Chlorobenzyl)-1H-benzimidazole is used in the pharmaceutical industry for the synthesis of drug...

Compound Q&A

What precautions should be taken when handling 2-(4-Chlorobenzyl)-1H-benzimidazole (CAS: 5468-66-6)?

When handling 2-(4-Chlorobenzyl)-1H-benzimidazole, it is essential to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...