Compound Q&A

How is 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1) typically synthesized?

Answer

Benzenesulfonic acid, 2-chloro-5-nitro-
2-Chloro-5-nitrobenzenesulfonic acid is usually synthesized from 5-nitrotoluene by chlorosulfonation. This process involves the reaction of 5-nitrotoluene with chlorosulfonic acid in the presence of a catalyst such as sulfuric acid. The reaction is exothermic and requires careful control of temperature to achieve high yield and selectivity.

About

CAS No 96-73-1
English Name Benzenesulfonic acid, 2-chloro-5-nitro-
Molecular Formula C6H4ClNO5S
Molecular Weight 237.62 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)O)Cl
InChIKey GNTARUIZNIWBCN-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1)?

2-Chloro-5-nitrobenzenesulfonic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1)?

2-Chloro-5-nitrobenzenesulfonic acid is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...