Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1)?

Answer

Benzenesulfonic acid, 2-chloro-5-nitro-
2-Chloro-5-nitrobenzenesulfonic acid is a crystalline solid with a molecular weight of approximately 277.03 g/mol. It has a melting point of about 230-233°C. The compound is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It is chemically reactive, particularly towards nucleophiles and reducing agents.

About

CAS No 96-73-1
English Name Benzenesulfonic acid, 2-chloro-5-nitro-
Molecular Formula C6H4ClNO5S
Molecular Weight 237.62 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)O)Cl
InChIKey GNTARUIZNIWBCN-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1) typically synthesized?

2-Chloro-5-nitrobenzenesulfonic acid is usually synthesized from 5-nitrotoluene by chlorosulfonation...

Compound Q&A

What industries use 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1)?

2-Chloro-5-nitrobenzenesulfonic acid is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitrobenzenesulfonic acid (CAS: 96-73-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...