Compound Q&A

What are the physical and chemical properties of 3-[(3R)-3-{[(4-Fluorophenyl)sulfonyl]amino}-1,2,3,4-tetrahydro-9H-carbazol-9-yl]propanoic acid (CAS: 116649-85-5)?

Answer

3-[(3R)-3-{[(4-Fluorophenyl)sulfonyl]amino}-1,2,3,4-tetrahydro-9H-carbazol-9-yl]propanoic acid
This compound is a crystalline solid with a high molecular weight. It has a low solubility in water but is more soluble in organic solvents. It shows moderate reactivity, particularly in nucleophilic substitution reactions. Its stability and reactivity make it suitable for various applications in organic synthesis.

About

English Name 3-[(3R)-3-{[(4-Fluorophenyl)sulfonyl]amino}-1,2,3,4-tetrahydro-9H-carbazol-9-yl]propanoic acid
Molecular Formula C21H21FN2O4S
Molecular Weight 416.47 g/mol
SMILES C1CC2=C(CC1NS(=O)(=O)C3=CC=C(C=C3)F)C4=CC=CC=C4N2CCC(=O)O
InChIKey LDXDSHIEDAPSSA-OAHLLOKOSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 3-[(3R)-3-{[(4-Fluorophenyl)sulfonyl]amino}-1,2,3,4-tetrahydro-9H-carbazol-9-yl]propanoic acid (CAS: 116649-85-5) typically synthesized?

The compound is synthesized through a multi-step process involving the condensation of a sulfonyl ch...

Compound Q&A

What industries use 3-[(3R)-3-{[(4-Fluorophenyl)sulfonyl]amino}-1,2,3,4-tetrahydro-9H-carbazol-9-yl]propanoic acid (CAS: 116649-85-5)?

This compound is primarily used in the pharmaceutical industry for developing novel drugs, as well a...

Compound Q&A

What precautions should be taken when handling 3-[(3R)-3-{[(4-Fluorophenyl)sulfonyl]amino}-1,2,3,4-tetrahydro-9H-carbazol-9-yl]propanoic acid (CAS: 116649-85-5)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...