Compound Q&A

What precautions should be taken when handling 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1)?

Answer

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
When handling this compound, it is necessary to wear appropriate personal protective equipment, including gloves, goggles, and a lab coat. Handling should be done in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbent materials. Refer to the safety data sheet (SDS) for more detailed information on handling and disposal.

About

CAS No 51410-72-1
English Name 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C10H21ClN2O
Molecular Weight 220.74 g/mol
SMILES C[N+](C)(C)CCCNC(C(C)=C)=O.[Cl-]
InChIKey UZNHKBFIBYXPDV-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1)?

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride has a crystalline form. Its molecular...

Compound Q&A

How is 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1) typically synthesized?

This compound is typically synthesized through the reaction of 3-methacrylamino-1-propanol with chlo...

Compound Q&A

What industries use 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1)?

This compound finds use in the pharmaceutical industry for drug delivery systems, in the polymer ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...