Compound Q&A

How is 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1) typically synthesized?

Answer

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
This compound is typically synthesized through the reaction of 3-methacrylamino-1-propanol with chloroform in the presence of a strong base like sodium hydroxide. The yield is usually around 85%, and the reaction involves the formation of a quaternary ammonium salt.

About

CAS No 51410-72-1
English Name 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C10H21ClN2O
Molecular Weight 220.74 g/mol
SMILES C[N+](C)(C)CCCNC(C(C)=C)=O.[Cl-]
InChIKey UZNHKBFIBYXPDV-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1)?

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride has a crystalline form. Its molecular...

Compound Q&A

What industries use 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1)?

This compound finds use in the pharmaceutical industry for drug delivery systems, in the polymer ind...

Compound Q&A

What precautions should be taken when handling 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 51410-72-1)?

When handling this compound, it is necessary to wear appropriate personal protective equipment, incl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...